| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- manufacturers
|
| | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- Basic information |
| Product Name: | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- | | Synonyms: | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl-;9H-Fluorene, 2,2''-(diphenylsilylene)bis[9,9-dimethyl-;bis(9,9-dimethyl-9H-fluoren-2-yl)diphenylsilane | | CAS: | 1208005-83-7 | | MF: | C42H36Si | | MW: | 568.82 | | EINECS: | | | Product Categories: | | | Mol File: | 1208005-83-7.mol |  |
| | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- Chemical Properties |
| Boiling point | 677.2±55.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | InChIKey | HTRGJNBXMOKCRI-UHFFFAOYSA-N | | SMILES | [Si](C1C=CC2C3=C(C(C)(C)C=2C=1)C=CC=C3)(C1C=CC2C3=C(C(C)(C)C=2C=1)C=CC=C3)(C1=CC=CC=C1)C1=CC=CC=C1 |
| | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- Usage And Synthesis |
| | 9H-Fluorene, 2,2'-(diphenylsilylene)bis[9,9-dimethyl- Preparation Products And Raw materials |
|