| Company Name: |
ChemOrigin Pharm Gold |
| Tel: |
15026428026 19002516454 |
| Email: |
ChemOrigin@126.com |
|
| | Pyridine, 3-bromo-5-iodo-2-[(1S)-1-methoxyethyl]- Basic information |
| | Pyridine, 3-bromo-5-iodo-2-[(1S)-1-methoxyethyl]- Chemical Properties |
| Boiling point | 292.6±40.0 °C(Predicted) | | density | 1.928±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature, keep dry and cool | | pka | 0.02±0.39(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H9BrINO/c1-5(12-2)8-7(9)3-6(10)4-11-8/h3-5H,1-2H3/t5-/m0/s1 | | InChIKey | DPRVXTXXJZAUBO-YFKPBYRVSA-N | | SMILES | C1([C@@H](OC)C)=NC=C(I)C=C1Br |
| | Pyridine, 3-bromo-5-iodo-2-[(1S)-1-methoxyethyl]- Usage And Synthesis |
| | Pyridine, 3-bromo-5-iodo-2-[(1S)-1-methoxyethyl]- Preparation Products And Raw materials |
|