|
|
| | 2-Amino-9,9-dimethylfluorene Basic information |
| Product Name: | 2-Amino-9,9-dimethylfluorene | | Synonyms: | 9H-Fluoren-2-amine,9,9-dimethyl-;Fluoren-2-amine,9,9-dimethyl-;2-AMINO-9,9-DIMETHYLFLUORENE;9,9-Dimethyl-9H-fluoren-2-amine;2-Amino-9,9-dimethyl-9H-fluorene;9,9-DiMethyl-9H-fluoren-2-a
Mine、2-AMino-9,9-diMethylfluorene;2-Amino-9,9-dimethyl;2-AMino-9,9-diMethylfluorene,9,9-diMethyl-2-AMinofluorene | | CAS: | 108714-73-4 | | MF: | C15H15N | | MW: | 209.29 | | EINECS: | 805-747-3 | | Product Categories: | OLED materials,pharm chemical,electronic;Fluorene Series;organic chemicals and derivatives/others;OLED;Electronic Chemicals | | Mol File: | 108714-73-4.mol |  |
| | 2-Amino-9,9-dimethylfluorene Chemical Properties |
| Melting point | 166.0 to 170.0 °C | | Boiling point | 374.2±21.0 °C(Predicted) | | density | 1.107 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Powder | | pka | 4.35±0.40(Predicted) | | color | Off-white | | InChI | InChI=1S/C15H15N/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15/h3-9H,16H2,1-2H3 | | InChIKey | GUTJITRKAMCHSD-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC=C2)C2=C1C=C(N)C=C2 | | CAS DataBase Reference | 108714-73-4(CAS DataBase Reference) |
| | 2-Amino-9,9-dimethylfluorene Usage And Synthesis |
| Chemical Properties | White solid | | Synthesis | General procedure for the synthesis of 9,9-dimethyl-9H-fluoren-2-amine from 2-nitro-9,9-dimethylfluorene: 23.9 g (100.0 mmol) of 2-nitro-9,9-dimethylfluorene and 0.5 g of 10% Pd/activated carbon catalyst were suspended in 500 mL of ethanol, and the reaction was stirred for 24 h under hydrogen atmosphere. Upon completion of the reaction, the catalyst was removed by filtration and the filtrate was concentrated under reduced pressure and purified by column chromatography to afford 16.9 g of the light yellow solid product 9,9-dimethyl-9H-fluoren-2-amine in 81% yield. The structure of the product was confirmed by high resolution mass spectrometry (HR-MS) (calculated value: [M+H]+ 209.1204, measured value: [M+H]+ 209.1194). | | References | [1] Journal of Materials Chemistry B, 2013, vol. 1, # 40, p. 5450 - 5455
[2] Patent: US8865322, 2014, B2. Location in patent: Page/Page column 26; 37; 38
[3] Patent: CN105418515, 2016, A. Location in patent: Paragraph 0012; 0040 |
| | 2-Amino-9,9-dimethylfluorene Preparation Products And Raw materials |
| Raw materials | Acetic acid-->Nitric acid-->n-Butyllithium-->Iodomethane-->ZINC-->Potassium Acetate-->Fluorene-->Acetamide, N-(9,9-dimethyl-9H-fluoren-2-yl)--->9,9-Dimethylfluorene-->2-Bromo-9,9-dimethylfluorene-->9,9-Dimethyl-2-nitrofluorene | | Preparation Products | N-(4-bromophenyl)-N-(9,9-dimethyl-9H-fluoren-2-yl)-9,9-dimethyl-9H-fluoren-2-amine-->N-(4-biphenyl)-(9,9-dimethylfluoren-2--yl)Amine-->2-BroMo-5,7-dihydro-7,7-diMethyl-5-phenyl-indeno[2,1-b]carbazole-->5,7-Dihydro-7,7-dimethyl-indeno[2,1-b]carbazole-->Bis-(9,9-diMethyl-9H-fluoren-2-yl)-aMine |
|