|
|
| | 4-(Chlorosulfonyl)-benzoic acid methyl ester Basic information |
| Product Name: | 4-(Chlorosulfonyl)-benzoic acid methyl ester | | Synonyms: | methyl 4-(chlorosulfonyl)benzoate(SALTDATA: FREE);4-(Methoxycarbonyl)benzenesulfonyl chloride;4-Carbomethoxybenzenesulfonyl chloride;Methyl p-(chlorosulfonyl)benzoate;p-(Carbomethoxy)benzenesulfonyl chloride;Benzoic acid, 4-(chlorosulfonyl)-, Methyl ester;METHYL 4-(CHLOROSULFONYL)BENZOATE(RS20013285);Benzoic acid, 4-(chlorosulfonyl)-, methyl ester (9CI) | | CAS: | 69812-51-7 | | MF: | C8H7ClO4S | | MW: | 234.66 | | EINECS: | | | Product Categories: | SULFONYLHALIDE | | Mol File: | 69812-51-7.mol |  |
| | 4-(Chlorosulfonyl)-benzoic acid methyl ester Chemical Properties |
| Melting point | 72-73℃ | | Boiling point | 126 °C(Press: 0.05 Torr) | | density | 1.431 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Faint to light orange | | InChI | InChI=1S/C8H7ClO4S/c1-13-8(10)6-2-4-7(5-3-6)14(9,11)12/h2-5H,1H3 | | InChIKey | MOFQDKOKODUZPK-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 |
| RIDADR | 3261 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2904990090 |
| | 4-(Chlorosulfonyl)-benzoic acid methyl ester Usage And Synthesis |
| Uses | 4-(Chlorosulfonyl)-benzoic acid methyl ester can be used as an organic synthesis raw material for the preparation of other heterocyclic compounds. | | Synthesis | General procedure for the synthesis of methyl 4-(chlorosulfonyl)benzoate from methanol and 4-(chlorosulfonyl)benzoyl chloride: 4-chlorosulfonylbenzoic acid (5 g, 23 mmol) was dissolved in dichloroethane (10 mL), thionyl chloride (20 mL) was added, and the reaction mixture was heated to 80 °C, and the reaction was maintained at this temperature for 2 hours. Upon completion of the reaction, the reaction mixture was concentrated by rotary evaporator to give a brown solid. The resulting solid was cooled in an ice bath for 5 min, followed by the slow addition of pre-cooled methanol (40 mL) at 0 °C with stirring, a process that lasted for 5 min. The reaction mixture was gradually warmed up to room temperature and stirring was continued for 10 minutes. Finally, ice-cold water (40 mL) was added, at which time a white solid precipitated, and the solid product was collected by filtration and dried under vacuum to afford pure methyl 4-(chlorosulfonyl)benzoate (4.5 g, 84% yield). The product was characterized by NMR (400 MHz, DMSO-d6): δ, ppm: 3.84 (s, 3H), 7.70 (d, 2H, J = 8.4Hz), 7.93 (d, 2H, J = 8.4Hz). | | References | [1] Patent: WO2005/66126, 2005, A1. Location in patent: Page/Page column 73-74 [2] Patent: US9247759, 2016, B2. Location in patent: Page/Page column 144; 145 [3] Recueil des Travaux Chimiques des Pays-Bas, 1957, vol. 76, p. 129,138,145 |
| | 4-(Chlorosulfonyl)-benzoic acid methyl ester Preparation Products And Raw materials |
|