2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE manufacturers
|
| | 2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE Basic information |
| Product Name: | 2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE | | Synonyms: | 2,4-Diamino-6-nonyl-s-triazine;6-Nonylguanamine;Caprinoguanamine;NSC254526;6-nonyl-1,3,5-triazine-2,4-diamine;6-Nonylguanamine
Caprinoguanamine;s-Triazine, 2,4-diaMino-6-nonyl-;2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE | | CAS: | 5921-65-3 | | MF: | C12H23N5 | | MW: | 237.34 | | EINECS: | 227-645-2 | | Product Categories: | | | Mol File: | 5921-65-3.mol |  |
| | 2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE Chemical Properties |
| Boiling point | 453.9±28.0 °C(Predicted) | | density | 1.068±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C | | pka | 4.46±0.10(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 7.317mg/L at 25℃ | | InChI | InChI=1S/C12H23N5/c1-2-3-4-5-6-7-8-9-10-15-11(13)17-12(14)16-10/h2-9H2,1H3,(H4,13,14,15,16,17) | | InChIKey | BDPPZSFVSOBOIX-UHFFFAOYSA-N | | SMILES | N1=C(CCCCCCCCC)N=C(N)N=C1N | | LogP | 3.83 at 20℃ |
| | 2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE Usage And Synthesis |
| Uses | 6-Nonyl-1,3,5-triazine-2,4-diamine is a useful research chemical compound used in the preparation of antiinflammatory 2,??4-??diamino-??6-??substituted-??s-??triazines. | | Flammability and Explosibility | Not classified |
| | 2,4-DIAMINO-6-NONYL-1,3,5-TRIAZINE Preparation Products And Raw materials |
|