|
|
| | Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) Basic information |
| Product Name: | Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) | | Synonyms: | 2-Chloro-5-(trifluoromethyl)-1,3-diazine;PyriMidine, 2-chloro-5-(trifluoroMethyl)-;2-Chloro-5-(trifluoroMethyl)pyriMidine 96%;Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI);Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) ISO 9001：2015 REACH;2-chloro-5-(trifluoromethyl)- (9CI);Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI)，2-chloro-5-(trifluoromethyl)pyrimidine;2-chloro-5-(trifluoromethyl) pyrimidine, 98%min | | CAS: | 69034-12-4 | | MF: | C5H2ClF3N2 | | MW: | 182.53 | | EINECS: | | | Product Categories: | PYRIMIDINE;byzjt | | Mol File: | 69034-12-4.mol |  |
| | Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) Chemical Properties |
| Melting point | 48-52°C | | Boiling point | 222.1±35.0 °C(Predicted) | | density | 1.504±0.06 g/cm3(Predicted) | | Fp | 71℃ | | storage temp. | -20°C | | pka | -3.48±0.22(Predicted) | | form | crystalline solid | | color | White | | InChI | InChI=1S/C5H2ClF3N2/c6-4-10-1-3(2-11-4)5(7,8)9/h1-2H | | InChIKey | TYCYTQLXAIDJNF-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C=N1 |
| Hazard Codes | Xi,T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) Usage And Synthesis |
| Uses | 2-Chloro-5-(trifluoromethyl)pyrimidine |
| | Pyrimidine, 2-chloro-5-(trifluoromethyl)- (9CI) Preparation Products And Raw materials |
|