| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | Pyridine, 2,5-difluoro-3-nitro- (9CI) Basic information |
| | Pyridine, 2,5-difluoro-3-nitro- (9CI) Chemical Properties |
| Boiling point | 232.6±35.0 °C(Predicted) | | density | 1.555±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -6.89±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H2F2N2O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H | | InChIKey | VGMUUROJPIKOIB-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(F)C=C1[N+]([O-])=O |
| | Pyridine, 2,5-difluoro-3-nitro- (9CI) Usage And Synthesis |
| | Pyridine, 2,5-difluoro-3-nitro- (9CI) Preparation Products And Raw materials |
|