- Phthaloyl amlodipine
-
- $0.00 / 25KG
-
2026-03-05
- CAS:88150-62-3
- Min. Order: 25KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | Phthaloyl amlodipine Basic information |
| Product Name: | Phthaloyl amlodipine | | Synonyms: | 3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate;1-Amino-6-fluoro-1,4-dihydro-7-(4-((5-methyl-2-oxo-1,3-dioxol-4-yl)methyl)piperazin-1-yl)-4-oxo-[1,3]thiazeto[3,2-A]quinoline-3-carboxylic acid;3-Ethyl-5-methyl-4-(2-chlorophenyl)-2-(2-phthalimidoethoxyl)methyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;4-(2-Chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-2-(phthalimidoethoxy)methyl-1,4-dihydropyridine;Phthalimidoamlodipine;3,5-Pyridinedicarboxylicacid,4-(2-chlorophenyl)-2-[[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]Methyl]-1,4-dihydro-6-Methyl-,3-ethyl 5-Methyl ester;4-(2-Chlorophenyl)-3-Ethoxy carbonyl-5-Methoxy carbonil-6-Methyl-2-(phthaliMidoethoxy)Methyl-1,4-dihydropyridine;4-(2-Chlorophenyl)-2-[[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]Methyl]-1,4-dihydro-6-Methyl-3,5-pyridinedicarboxylic Acid 3-Ethyl 5-Methyl Ester | | CAS: | 88150-62-3 | | MF: | C28H27ClN2O7 | | MW: | 538.98 | | EINECS: | 413-410-3 | | Product Categories: | API intermediates;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 88150-62-3.mol |  |
| | Phthaloyl amlodipine Chemical Properties |
| Melting point | 140-145°C | | Boiling point | 654.1±55.0 °C(Predicted) | | density | 1.321±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated and Sonicated) | | pka | 2.06±0.70(Predicted) | | color | Pale Yellow to Light Yellow | | PH | 6.78 at 20.4℃ and 10g/L | | Major Application | pharmaceutical (small molecule) | | InChIKey | AHHPZGUFLGCZCF-UHFFFAOYSA-N | | SMILES | C1(COCCN2C(=O)C3=C(C2=O)C=CC=C3)NC(C)=C(C(OC)=O)C(C2=CC=CC=C2Cl)C=1C(OCC)=O | | LogP | 4.9 at 30℃ and pH6.79 | | CAS DataBase Reference | 88150-62-3(CAS DataBase Reference) |
| Risk Statements | 53 | | Safety Statements | 61 | | WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Phthaloyl amlodipine Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Amilodopine intermediate | | Uses | Amlodipine intermediate. Amlodipine Related Compound A |
| | Phthaloyl amlodipine Preparation Products And Raw materials |
|