|
|
| | 3,5-DI-TERT-BUTYLBENZOIC ACID Basic information |
| | 3,5-DI-TERT-BUTYLBENZOIC ACID Chemical Properties |
| Melting point | 173-175 °C(lit.) | | Boiling point | 361.43°C (estimate) | | density | 0.9725 (estimate) | | refractive index | 1.5283 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder or Crystalline Powder | | pka | 4.40±0.10(Predicted) | | color | White to off-white | | Water Solubility | Insoluble in water. | | BRN | 981248 | | InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6/h7-9H,1-6H3,(H,16,17) | | InChIKey | NCTSLPBQVXUAHR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | CAS DataBase Reference | 16225-26-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 3,5-DI-TERT-BUTYLBENZOIC ACID Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 3,5-Di-tert-butylbenzoic acid is used in the synthesis of 5,5-di-tert-butylanilinium sulfate. |
| | 3,5-DI-TERT-BUTYLBENZOIC ACID Preparation Products And Raw materials |
|