| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Benz-13C6-aldehyde Basic information |
| Product Name: | Benz-13C6-aldehyde | | Synonyms: | BENZALDEHYDE (RING-13C6);BENZALDEHYDE-(PHENYL-13C6);[13C6]-benzaldehyde;Benz-13C?-aldehyde;Benz-13C6-aldehyde;Benzaldehyde (ring-13C?, 99%) + 0.1% hydroquinone;Benz-13C6-aldehyde | | CAS: | 153489-14-6 | | MF: | C7H6O | | MW: | 112.08 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Benz-13C6-aldehyde Chemical Properties |
| Melting point | -26 °C(lit.) | | Boiling point | 178-179 °C(lit.) | | density | 1.103 g/mL at 25 °C | | Fp | 145 °F | | InChI | 1S/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H/i1+1,2+1,3+1,4+1,5+1,7+1 | | InChIKey | HUMNYLRZRPPJDN-ZXJNGCBISA-N | | SMILES | O=C[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24 | | RIDADR | UN 1990 9/PG 3 | | WGK Germany | 1 | | RTECS | CU4375000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |
| | Benz-13C6-aldehyde Usage And Synthesis |
| Uses | Benzaldehyde-(phenyl-13C6) is used in the synthesis of carbon-13 phenethylamines for drug quantification in biological samples |
| | Benz-13C6-aldehyde Preparation Products And Raw materials |
|