Benzoic acid, 4-hydroxy-, 2-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)hydrazide manufacturers
- c-Met-IN-15
-
- $40.00
-
2026-08-08
- CAS:330572-32-2
- Purity: 99.58%
- Supply Ability: 10g
|
| | Benzoic acid, 4-hydroxy-, 2-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)hydrazide Basic information |
| | Benzoic acid, 4-hydroxy-, 2-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)hydrazide Chemical Properties |
| density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 15 mg/mL (50.12 mM);Ethanol: Insoluble | | pka | 7.91±0.20(Predicted) | | form | Solid | | color | Orange to reddish brown | | Water Solubility | Water: Insoluble | | InChI | InChI=1S/C15H10FN3O3/c16-9-3-6-12-11(7-9)13(15(22)17-12)18-19-14(21)8-1-4-10(20)5-2-8/h1-7,20H,(H,19,21)(H,17,18,22) | | InChIKey | XFOZYIOLARIYOX-UHFFFAOYSA-N | | SMILES | C(NN=C1C2=C(NC1=O)C=CC(F)=C2)(=O)C1=CC=C(O)C=C1 |
| | Benzoic acid, 4-hydroxy-, 2-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)hydrazide Usage And Synthesis |
| Uses | c-Met-IN-15 (compound S3) is a c-Met kinase inhibitor. c-Met-IN-15 inhibits c-Met kinase activity of 21.1% at the concentration of 10 μM[1]. | | References | [1] Liang Z, et, al. Identification and synthesis of N'-(2-oxoindolin-3-ylidene)hydrazide derivatives against c-Met kinase. Bioorg Med Chem Lett. 2011 Jun 15;21(12):3749-54. DOI:10.1016/j.bmcl.2011.04.064 |
| | Benzoic acid, 4-hydroxy-, 2-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)hydrazide Preparation Products And Raw materials |
|