- 7-AMCA
-
- $0.00 / 1gram
-
2025-12-25
- CAS:24701-69-7
- Min. Order: 1gram
- Purity: 99%
- Supply Ability: 10kg
- 7-AMCA
-
- $0.00 / 25kg
-
2024-03-28
- CAS:24701-69-7
- Min. Order: 25kg
- Purity: HPLC>98%
- Supply Ability: Inquiry
|
| Product Name: | 7-AMCA | | Synonyms: | 7-AMINO-3-METHOXYMETHYL-3-CEPHEM-4-CARBOXYLIC ACID;7-amino 3-methyloxymethyl-3-cephem 4-carboxylic acid;7-AMCA;7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;(6R,7R)-7-AMino-3-(MethoxyMethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;7-AMINO 3-METHYLOXYMETHYL-3-CEPHEM 4-CARBOXYLIC AICD;7-AMino-3-MethoxyMethyl-3-cepheM-4-carboxylicacid (7-AMCA);Cefpodoxime Proxetil Impurity 18 | | CAS: | 24701-69-7 | | MF: | C9H12N2O4S | | MW: | 244.27 | | EINECS: | 435-680-1 | | Product Categories: | Amines | | Mol File: | 24701-69-7.mol |  |
| | 7-AMCA Chemical Properties |
| Boiling point | 519.4±50.0 °C(Predicted) | | density | 1.55 | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C(protect from light) | | pka | 2.70±0.50(Predicted) | | Water Solubility | 87.7mg/L at 20℃ | | InChI | InChI=1S/C9H12N2O4S/c1-15-2-4-3-16-8-5(10)7(12)11(8)6(4)9(13)14/h5,8H,2-3,10H2,1H3,(H,13,14)/t5-,8-/m1/s1 | | InChIKey | BDSDFCVDQUGOFB-SVGQVSJJSA-N | | SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(COC)=C2C(O)=O | | LogP | -2.5 at 20℃ |
| | 7-AMCA Usage And Synthesis |
| Chemical Properties | 7-Amino-3-methyl-3-cephem-4-carboxylic acid (7-AMCA) has a density of 1.55, a boiling point of 511.4℃ at 760 mmHg, a flash point of 263.1℃, and is stored protected from light, tightly sealed and dry, and stored at 2-8℃. | | Uses | 7-Amino-3-(methoxymethyl)-3-cephem-4-carboxylic Acid is a reactant in the preparation of prodrug-type cephalosporins. | | Flammability and Explosibility | Non flammable |
| | 7-AMCA Preparation Products And Raw materials |
|