|
|
| | 3-Fluoro-4-nitrobenzonitrile Basic information |
| Product Name: | 3-Fluoro-4-nitrobenzonitrile | | Synonyms: | 4-Cyano-2-fluoronitrobenzene;3-FLUORO-4-NITROBENZONITRILE;Benzonitrile, 3-fluoro-4-nitro-;3-FLUORO-4-NITROBENZONITRIE;3-Fluoro-4-nitrobenzonitrile 99%;3-Fluoro-4-nitrobenzonitrile, 95% | | CAS: | 218632-01-0 | | MF: | C7H3FN2O2 | | MW: | 166.11 | | EINECS: | | | Product Categories: | | | Mol File: | 218632-01-0.mol |  |
| | 3-Fluoro-4-nitrobenzonitrile Chemical Properties |
| Melting point | 72-73°C | | Boiling point | 316.4±27.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H3FN2O2/c8-6-3-5(4-9)1-2-7(6)10(11)12/h1-3H | | InChIKey | OZXCOGPRBUSXLE-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C([N+]([O-])=O)C(F)=C1 | | CAS DataBase Reference | 218632-01-0(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | HazardClass | IRRITANT | | HS Code | 2926907090 |
| | 3-Fluoro-4-nitrobenzonitrile Usage And Synthesis |
| Uses | 3-Fluoro-4-nitrobenzonitrile (cas# 218632-01-0) is a used in preparation of substituted benzimidazole derivatives as GLP-1r modulating compounds. |
| | 3-Fluoro-4-nitrobenzonitrile Preparation Products And Raw materials |
|