|
|
| | 4-Chloro-3,5-dibromo-tert-butylbenzene Basic information |
| Product Name: | 4-Chloro-3,5-dibromo-tert-butylbenzene | | Synonyms: | 4-Chloro-3,5-dibromo-tert-butylbenzene;3,5-Dibromo-4-chloro-tert-butylbenzene;Benzene, 1,3-dibromo-2-chloro-5-(1,1-dimethylethyl)-;1,3-Dibromo-5-(tert-butyl)-2-chlorobenzene - [D94393];1,3-dibromo-5-(tert-butyl)-2-chlorobenzene | | CAS: | 1000578-25-5 | | MF: | C10H11Br2Cl | | MW: | 326.46 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Chloro-3,5-dibromo-tert-butylbenzene Chemical Properties |
| Boiling point | 287.6±35.0 °C(Predicted) | | density | 1.628±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H11Br2Cl/c1-10(2,3)6-4-7(11)9(13)8(12)5-6/h4-5H,1-3H3 | | InChIKey | WMMPUKCLMBOGTC-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C(C)(C)C)=CC(Br)=C1Cl |
| | 4-Chloro-3,5-dibromo-tert-butylbenzene Usage And Synthesis |
| | 4-Chloro-3,5-dibromo-tert-butylbenzene Preparation Products And Raw materials |
|