|
|
| | 2-Chloro-6-fluorobromobenzene Basic information |
| Product Name: | 2-Chloro-6-fluorobromobenzene | | Synonyms: | 2-Chloro-6-fluorobromobenzene;Benzene, 2-bromo-1-chloro-3-fluoro-;2-Bromo-1-chloro-3-fluorobenzene;2-Bromo-1-Chloro-6-Fluorobenzene (or 2-Bromo-6-Fluorobenzene, - | | CAS: | 309721-44-6 | | MF: | C6H3BrClF | | MW: | 209.44 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Chloro-6-fluorobromobenzene Chemical Properties |
| Boiling point | 198℃ | | density | 1.719 | | refractive index | n20D 1.55 (Predicted) | | Fp | 73℃ | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Colourless | | InChI | InChI=1S/C6H3BrClF/c7-6-4(8)2-1-3-5(6)9/h1-3H | | InChIKey | GBESIUPWXGQOFP-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(F)=C1Br |
| | 2-Chloro-6-fluorobromobenzene Usage And Synthesis |
| Uses | 2-Chloro-6-fluorobromobenzene is a polyhalogenated compound containing chlorine, bromine and fluorine functional groups on its benzene ring structure, and can be used in the preparation of organic electroluminescent materials. |
| | 2-Chloro-6-fluorobromobenzene Preparation Products And Raw materials |
|