- (R)-HOMO-BETA-VALINE
-
- $1.00 / 1KG
-
2019-07-06
- CAS:75992-50-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,100kg
|
| | (R)-HOMO-BETA-VALINE
Basic information |
| Product Name: | (R)-HOMO-BETA-VALINE
| | Synonyms: | (R)-HOMO-BETA-VALINE;REF DUPL: (R)-beta-homovaline;D-β-Hoval-OH;Pentanoic acid, 3-amino-4-methyl-, (3R)-;L-BETA-LEUCINE;L-beta-homovaline | | CAS: | 75992-50-6 | | MF: | C6H13NO2 | | MW: | 131.17 | | EINECS: | | | Product Categories: | | | Mol File: | 75992-50-6.mol |  |
| | (R)-HOMO-BETA-VALINE
Chemical Properties |
| Melting point | 206℃ | | Boiling point | 232.0±23.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.81±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 | | InChIKey | GLUJNGJDHCTUJY-RXMQYKEDSA-N | | SMILES | C(O)(=O)C[C@@H](N)C(C)C |
| | (R)-HOMO-BETA-VALINE
Usage And Synthesis |
| Definition | ChEBI: (3R)-beta-leucine is the (3R)-beta-isomer of leucine. It is an enantiomer of a (3S)-beta-leucine. It is a tautomer of a (3R)-beta-leucine zwitterion. |
| | (R)-HOMO-BETA-VALINE
Preparation Products And Raw materials |
|