|
|
| | 2-Isonitrosoacetophenone Basic information |
| | 2-Isonitrosoacetophenone Chemical Properties |
| Melting point | 126-128 °C (lit.) | | Boiling point | 270.21°C (rough estimate) | | density | 1.2517 (rough estimate) | | refractive index | 1.5320 (estimate) | | storage temp. | 2-8°C | | pka | 8.49±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | Water Solubility | SOLUBLE IN COLD WATER | | Merck | 14,5191 | | BRN | 2041691 | | InChI | InChI=1S/C8H7NO2/c10-8(6-9-11)7-4-2-1-3-5-7/h1-6,11H/b9-6+ | | InChIKey | MLNKXLRYCLKJSS-RMKNXTFCSA-N | | SMILES | C1(C=CC=CC=1)C(=O)/C=N/O | | CAS DataBase Reference | 532-54-7(CAS DataBase Reference) | | EPA Substance Registry System | Isonitrosoacetophenone (532-54-7) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36/37-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | MD3325000 | | TSCA | TSCA listed | | HS Code | 2922390090 | | Storage Class | 11 - Combustible Solids |
| | 2-Isonitrosoacetophenone Usage And Synthesis |
| Chemical Properties | beige to yellowish crystalline powder | | Uses | As a reagent for the detection of ferrous ions with which it gives a blue color soluble in chloroform. | | Uses | 2-Isonitrosoacetophenone is used to make a complex with copper and amino acids. These complexes has shown to have more antimicrobial activities against gram positive bacteria than gram negative bacteria and the complexes also have antioxidant activity. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 39, p. 2558, 1974 DOI: 10.1021/jo00931a022 | | Purification Methods | Crystallise it from water. [Beilstein 7 IV 2132.] |
| | 2-Isonitrosoacetophenone Preparation Products And Raw materials |
|