Coumarin 334 manufacturers
- Coumarin 334
-
- $1400.00 / 5g
-
2024-04-02
- CAS:55804-67-6
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
|
| | Coumarin 334 Basic information |
| Product Name: | Coumarin 334 | | Synonyms: | 1h,5h,11h-[1]benzopyrano[6,7,8-ij]quinolizin-11-one,10-acetyl-2,3,6,7-tetrahyd;C 334;COUMARIN 521;COUMARIN 334;1H,5H,11H-[1]BENZOPYRANO[6,7,8-IJ]QUINOLIZIN-11-ONE, 10-ACETYL-2,3,6,7-TETRAHYDRO-;10-ACETYL-2,3,6,7-TETRAHYDRO-1H,5H,11H-[1]BENZOPYRANO[6,7,8-IJ]QUINOLIZIN-11-ONE;10-ACETYL-2,3,6,7-TETRAHYDRO-1H,5H,11H-PYRANO[2,3-F]PYRIDO[3,2,1-IJ]QUINOLIN-11-ONE;9-ACETYL-10-OXO-2,3,5,6-TETRAHYDRO-1H,4H,10H-11-OXA-3A-AZA-BENZO[DE]ANTHRACENE | | CAS: | 55804-67-6 | | MF: | C17H17NO3 | | MW: | 283.32 | | EINECS: | 259-826-7 | | Product Categories: | C;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 55804-67-6.mol |  |
| | Coumarin 334 Chemical Properties |
| Melting point | 181-184 °C(lit.) | | Boiling point | 425.88°C (rough estimate) | | density | 1.1077 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | room temp | | solubility | ethanol: 10mg/mL | | pka | 5.37±0.40(Predicted) | | form | powder or crystals | | Water Solubility | NEGLIGIBLE | | ε(extinction coefficient) | ≥45000 at 449-455nm in ethanol | | λmax | 452 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C17H17NO3/c1-10(19)14-9-12-8-11-4-2-6-18-7-3-5-13(15(11)18)16(12)21-17(14)20/h8-9H,2-7H2,1H3 | | InChIKey | JBPCDMSEJVCNGV-UHFFFAOYSA-N | | SMILES | CC(=O)C1=Cc2cc3CCCN4CCCc(c2OC1=O)c34 | | EPA Substance Registry System | 1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizin-11-one, 10-acetyl-2,3,6,7-tetrahydro- (55804-67-6) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | Storage Class | 11 - Combustible Solids |
| | Coumarin 334 Usage And Synthesis |
| Description | Coumarin 521 is a highly versatile compound widely employed in the biomedical sector and plays an indispensable role in the advancement of pharmaceuticals aimed at combating a myriad of ailments including cancer, diabetes, and cardiovascular disorders. Its distinct attributes facilitate meticulous investigations into potential therapeutic targets and mechanisms of action. Serving as a fluorescent probe, Coumarin 521 proves invaluable for disease identification and monitoring, thus garnering substantial significance in the medical fraternity. | | Chemical Properties | orange crystalline powder | | Uses | Suitable as a laser dye. | | Uses | Coumarin 334 is a laser dye with an absorption maximum of 452 nm. Dyes and metabolites. | | Excitation / Emission Maximum | 445 nm/475 nm |
| | Coumarin 334 Preparation Products And Raw materials |
|