BIS(2-ETHYLHEXYL) PHOSPHITE manufacturers
|
| | BIS(2-ETHYLHEXYL) PHOSPHITE Basic information |
| | BIS(2-ETHYLHEXYL) PHOSPHITE Chemical Properties |
| density | 0.916 g/mL at 25 °C(lit.) | | vapor pressure | 0-0.009Pa at 20-50℃ | | refractive index | n20/D 1.442(lit.) | | Fp | >230 °F | | Boiling point | 174 °C(Press: 7 Torr) | | form | Liquid | | InChI | InChI=1S/C16H35O3P/c1-5-9-11-15(7-3)13-18-20(17)19-14-16(8-4)12-10-6-2/h15-16,20H,5-14H2,1-4H3 | | InChIKey | HZIUHEQKVCPTAJ-UHFFFAOYSA-N | | SMILES | P(=O)(OCC(CC)CCCC)OCC(CC)CCCC | | LogP | 6.5 at 25℃ | | CAS DataBase Reference | 3658-48-8(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonic acid, bis(2-ethylhexyl) ester (3658-48-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | RTECS | SZ6840000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 3658-48-8(Hazardous Substances Data) | | Toxicity | guinea pig,LD50,intraperitoneal,700mg/kg (700mg/kg),BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD,AMA Archives of Industrial Health. Vol. 18, Pg. 464, 1958. |
| | BIS(2-ETHYLHEXYL) PHOSPHITE Usage And Synthesis |
| Uses | Bis(2-ethylhexyl) Phosphite is used as a supported liquid membranes (SLMs) for electromembrane extraction (EME) of basic drugs from human plasma samples. | | General Description | Bis(2-ethylhexyl) phosphite is an chemical warfare simulant and its reaction with common ion binary ionic liquid has been investigated. Mass-transfer kinetics of Eu3+ and Am3+ in bis(2-ethylhexyl) phosphite-n-dodecane-NaCl-HCl-water system has been investigated. |
| | BIS(2-ETHYLHEXYL) PHOSPHITE Preparation Products And Raw materials |
|