- 1,3-Propanediol, 2-propyl-
-
- $30.00 / 1KG
-
2025-09-25
- CAS:2612-28-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-N-PROPYLPROPANE-1,3-DIOL Basic information |
| Product Name: | 2-N-PROPYLPROPANE-1,3-DIOL | | Synonyms: | 1,1-BIS(HYDROXYMETHYL)BUTANE;2-PROPYL-1,3-PROPANEDIOL;2-N-PROPYLPROPANE-1,3-DIOL;2-N-PROPYL-1,3-PROPANEDIOL, 98%;1-bis(hydroxymethyl)butane;2-propylpropane-1,3-diol;1,3-Propanediol, 2-propyl- | | CAS: | 2612-28-4 | | MF: | C6H14O2 | | MW: | 118.17 | | EINECS: | | | Product Categories: | Propanes/propenes | | Mol File: | 2612-28-4.mol |  |
| | 2-N-PROPYLPROPANE-1,3-DIOL Chemical Properties |
| Melting point | 26.38°C (estimate) | | Boiling point | 221.7°C (rough estimate) | | density | 0.9843 (rough estimate) | | refractive index | 1.4480 | | storage temp. | 2-8°C | | pka | 14.51±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H14O2/c1-2-3-6(4-7)5-8/h6-8H,2-5H2,1H3 | | InChIKey | FZHZPYGRGQZBCV-UHFFFAOYSA-N | | SMILES | C(O)C(CCC)CO |
| Provider | Language |
|
ALFA
| English |
| | 2-N-PROPYLPROPANE-1,3-DIOL Usage And Synthesis |
| | 2-N-PROPYLPROPANE-1,3-DIOL Preparation Products And Raw materials |
|