|
|
| | 2-Pyridinecarboxylic acid, 5,6-dichloro- Basic information |
| Product Name: | 2-Pyridinecarboxylic acid, 5,6-dichloro- | | Synonyms: | 2-Pyridinecarboxylic acid, 5,6-dichloro-;5,6-dichloropicolinic acid;5,6-Dichloropyridine-2-carboxylic acid;2,3Dichloro6carboxypyridine;5,6-Dichloro-2-pyridinecarboxylic acid
5,6dichloropicolinic acid;5,6-Dichloro-2-pyridinecarboxylicacid;5,6-Dichloropicolinic acid 98%;5,6-Dichloropyridine-2-carboxylicacid,98% | | CAS: | 88912-24-7 | | MF: | C6H3Cl2NO2 | | MW: | 192 | | EINECS: | | | Product Categories: | | | Mol File: | 88912-24-7.mol |  |
| | 2-Pyridinecarboxylic acid, 5,6-dichloro- Chemical Properties |
| Boiling point | 342.1±37.0 °C(Predicted) | | density | 1.612±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.04±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H3Cl2NO2/c7-3-1-2-4(6(10)11)9-5(3)8/h1-2H,(H,10,11) | | InChIKey | QOJNAEPFSUYAFL-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC(Cl)=C(Cl)C=C1 |
| | 2-Pyridinecarboxylic acid, 5,6-dichloro- Usage And Synthesis |
| Uses | 2-Pyridinecarboxylic acid, 5,6-dichlorois known for its role in the
synthesis of pharmaceuticals and agrochemicals, as well as its utility
as a building block in organic synthesis and a reagent in various
chemical reactions. | | Synthesis | 5-Chloro-1-yloxy-pyridine-2-carboxylic acid (CAS: 1415898-80-4, 1.2 g, 7 mmol) was used as a raw material and was slowly added to phosphorus trichloride (POCl3, 10 g) at 0 °C. The reaction mixture was warmed up to 95 °C and maintained at this temperature for 1 hour. After completion of the reaction, the mixture was concentrated to dryness under reduced pressure. The residue was dissolved in water (15 mL) and extracted with ethyl acetate (2 × 15 mL). The organic phases were combined and washed sequentially with water (2 × 30 mL) and saturated saline (30 mL). The organic phase was dried over anhydrous sodium sulfate and concentrated under reduced pressure to afford 5,6-dichloro-2-pyridinecarboxylic acid (1 g, 75% yield) as a yellow solid. The product was confirmed by mass spectrometry (EI), m/e = 191.9 [M + H]+. | | References | [1] Patent: US2012/316147, 2012, A1. Location in patent: Page/Page column 66
[2] Patent: WO2012/168350, 2012, A1. Location in patent: Page/Page column 140 |
| | 2-Pyridinecarboxylic acid, 5,6-dichloro- Preparation Products And Raw materials |
|