|
|
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Basic information |
| Product Name: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether | | Synonyms: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether;Oxirane, methyl oxirane, bis(1-methylpropyl)phenyl polymer;di(sec-butyl)phenol ethoxylated, propoxylated;Alkylphenol alkoxylate;Ethoxylated propoxylated di-sec-butylphenol;Oxirane polymer with methyloxirane mono[bis(1-methylpropyl)phenyl] ether;PG 26-2;PG 26-3 | | CAS: | 69029-39-6 | | MF: | C14H22O.(C3H6O)n.(C2H4O)x | | MW: | 0 | | EINECS: | | | Product Categories: | Polymers | | Mol File: | Mol File | ![Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Structure]() |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Chemical Properties |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Usage And Synthesis |
| Toxics Screening Level | The ITSL for polyglycol 26-2 has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on an annual averaging time. |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Preparation Products And Raw materials |
|