| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 4-Chloro-2-trimethylsilylpyridine Basic information |
| | 4-Chloro-2-trimethylsilylpyridine Chemical Properties |
| form | solid | | InChI | 1S/C8H12ClNSi/c1-11(2,3)8-6-7(9)4-5-10-8/h4-6H,1-3H3 | | InChIKey | RLKBPYBYWSLVLF-UHFFFAOYSA-N | | SMILES | ClC1=CC([Si](C)(C)C)=NC=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Chloro-2-trimethylsilylpyridine Usage And Synthesis |
| | 4-Chloro-2-trimethylsilylpyridine Preparation Products And Raw materials |
|