|
|
| | 4-(TRIFLUOROMETHYL)STYRENE Basic information |
| Product Name: | 4-(TRIFLUOROMETHYL)STYRENE | | Synonyms: | 4-VINYLBENZOTRIFLUORIDE;4-(TRIFLUOROMETHYL)STYRENE;4-(Trifluoromethyl)styrene,4-Vinylbenzotrifluoride;4-(Trifluoromethyl)styrene, stabilized with 0.1% 4-tert-butylcatechol, 98+%;4-(Trifluoromethyl)styrene 98%;4-(TrifluoroMethyl)styrene, 98%, stab.;4-Vinylbenzotrifluoride, 1-Ethenyl-4-(trifluoromethyl)benzene;1-ethenyl-4-(trifluoroMethyl)benzene | | CAS: | 402-50-6 | | MF: | C9H7F3 | | MW: | 172.15 | | EINECS: | | | Product Categories: | | | Mol File: | 402-50-6.mol |  |
| | 4-(TRIFLUOROMETHYL)STYRENE Chemical Properties |
| Boiling point | 65-66 °C40 mm Hg(lit.) | | density | 1.165 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.466(lit.) | | Fp | 108 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to pale yellow | | Water Solubility | Insoluble in water. | | Sensitive | Light Sensitive | | BRN | 1863548 | | InChI | InChI=1S/C9H7F3/c1-2-7-3-5-8(6-4-7)9(10,11)12/h2-6H,1H2 | | InChIKey | CEWDRCQPGANDRS-UHFFFAOYSA-N | | SMILES | C1(C=C)=CC=C(C(F)(F)F)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Light Sensitive/Irritant | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 4-(TRIFLUOROMETHYL)STYRENE Usage And Synthesis |
| Chemical Properties | Clear light yellow liquid | | Uses | 4-(Trifluoromethyl)styrene is used as an organic chemical synthesis intermediate. | | Synthesis Reference(s) | Synthetic Communications, 18, p. 1795, 1988 DOI: 10.1080/00397918808060934 |
| | 4-(TRIFLUOROMETHYL)STYRENE Preparation Products And Raw materials |
|