|
|
| | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester Basic information |
| Product Name: | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester | | Synonyms: | methyl 5-trifluoromethyl-2-pyridinecarboxylate;Methyl 5-(trifluoromethyl)picolinate;Methyl 5-(trifluoromethyl)pyridine-2-carboxylate;2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,methyl ester;Methyl 3-(trifluoroMethyl)-5-pyridinecarboxylate;METHYL 5-(TRIFLUOROMETHYL)PYRIDIN-CARBOXYLATE;5-TRIFLUOROMETHYL-PYRIDINE-2-CARBOXYLICACIDMETHYLESTER ISO 9001:2015 REACH;5-trifluoromethyl-pyridine-2-carboxylic acid methyl ester | | CAS: | 124236-37-9 | | MF: | C8H6F3NO2 | | MW: | 205.13 | | EINECS: | | | Product Categories: | Pyridines | | Mol File: | 124236-37-9.mol |  |
| | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 248.0±40.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -0.73±0.10(Predicted) | | form | solid | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3 | | InChIKey | CHRQADSGOKVKER-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC=C(C(F)(F)F)C=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester Usage And Synthesis |
| Uses | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester is a pharmaceutical intermediate for naphthoquinone derivatives used in the treatment of oxidative stress disorders, modulators of cystic fibrosis transmembrane conductance modulators. |
| | 5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|