4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE manufacturers
|
| | 4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE Basic information |
| Product Name: | 4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE | | Synonyms: | 1-(6-acetyl-2-biphenylenyl)ethanone;4-(1,1,2,2-tetrafluoroethoxy)-benzaldehyd;4-TETRAFLUOROETHOXYBENZALDEHYDE;4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE;4-(1,1,2,2-Tetrafluoroethoxy)benzaldehyde98%;p-(1,1,2,2-tetrafluoroethoxy)benzaldehyde;4-(2H-Tetrafluoroethoxy)benzaldehyde 98%;Benzaldehyde,4-(1,1,2,2-tetrafluoroethoxy)- | | CAS: | 35295-36-4 | | MF: | C9H6F4O2 | | MW: | 222.14 | | EINECS: | 252-497-0 | | Product Categories: | Aldehydes;C9;Carbonyl Compounds | | Mol File: | 35295-36-4.mol |  |
| | 4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE Chemical Properties |
| Melting point | 9 °C | | Boiling point | 227 °C (lit.) | | density | 1.343 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.46(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | 1S/C9H6F4O2/c10-8(11)9(12,13)15-7-3-1-6(5-14)2-4-7/h1-5,8H | | InChIKey | ZTBIQWAGWYPSHC-UHFFFAOYSA-N | | SMILES | FC(F)C(F)(F)Oc1ccc(C=O)cc1 | | CAS DataBase Reference | 35295-36-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzaldehyde, 4-(1,1,2,2-tetrafluoroethoxy)- (35295-36-4) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Toxic | | TSCA | TSCA listed | | HS Code | 2913000090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE Usage And Synthesis |
| Uses | 4-(1,1,2,2-Tetrafluoroethoxy)benzaldehyde may be used in chemical synthesis. |
| | 4-(1,1,2,2-TETRAFLUOROETHOXY)BENZALDEHYDE Preparation Products And Raw materials |
|