| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-(0)57185586718 +86-13336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:2,2,8,8-Tetramethyl-3,7-dioxa-2,8-disilanonane CAS:17887-80-8 Purity:98%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | NISTC17887808 Basic information |
| Product Name: | NISTC17887808 | | Synonyms: | NISTC17887808;1,3-Bis(trimethylsiloxy)propane;2,2,8,8-Tetramethyl-2,8-disila-3,7-dioxanonane;2,2,8,8-tetraMethyl-3,7-dioxa-2,8-disilanonane;trimethyl(3-trimethylsilyloxypropoxy)silane;1,3-Bis(trimethylsilyloxy)propane >3,7-Dioxa-2,8-disilanonane, 2,2,8,8-tetramethyl-;NISTC | | CAS: | 17887-80-8 | | MF: | C9H24O2Si2 | | MW: | 220.46 | | EINECS: | | | Product Categories: | | | Mol File: | 17887-80-8.mol |  |
| | NISTC17887808 Chemical Properties |
| Boiling point | 77°C/15mmHg(lit.) | | density | 0.843 g/cm3 | | refractive index | 1.4040 to 1.4080 | | Fp | 62° | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C9H24O2Si2/c1-12(2,3)10-8-7-9-11-13(4,5)6/h7-9H2,1-6H3 | | InChIKey | DWHYMKOUICVFHL-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)OCCCO[Si](C)(C)C |
| | NISTC17887808 Usage And Synthesis |
| | NISTC17887808 Preparation Products And Raw materials |
|