- 2,6-Pyrazinediamine
-
-
2022-01-04
- CAS:41536-80-5
- Min. Order: 1g
- Purity: 98%minHPLC
- Supply Ability: 25kgs/month
|
| | 2,6-Pyrazinediamine(9CI) Basic information |
| | 2,6-Pyrazinediamine(9CI) Chemical Properties |
| Melting point | 137-138℃ | | Boiling point | 394.1±37.0 °C(Predicted) | | density | 1.368±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.44±0.10(Predicted) | | Appearance | Brown to black Solid | | InChI | InChI=1S/C4H6N4/c5-3-1-7-2-4(6)8-3/h1-2H,(H4,5,6,8) | | InChIKey | GYRUCENCQMAGLO-UHFFFAOYSA-N | | SMILES | C1(N)=NC(N)=CN=C1 |
| | 2,6-Pyrazinediamine(9CI) Usage And Synthesis |
| | 2,6-Pyrazinediamine(9CI) Preparation Products And Raw materials |
|