| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI) Basic information |
| Product Name: | 1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI) | | Synonyms: | Methyl (S)-Indoline-2-carboxylic acid;(S)-2,3-dihydro-1H-indol-2-carboxylic acid methyl ester;(S)-(+)-Methyl indoline-2-carboxylate;1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI);(S)-(+)-Methyl indoline-2-carboxylate >=97.0% (HPLC);1H-Indole-2-carboxylic acid, 2,3-dihydro-, methyl ester, (2S)-;Methyl (S)-indoline-2-carboxylate;(S)-(+)-Methyl indoline-2-carboxylate | | CAS: | 141410-06-2 | | MF: | C10H11NO2 | | MW: | 177.2 | | EINECS: | | | Product Categories: | PYRROLE | | Mol File: | 141410-06-2.mol |  |
| | 1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI) Chemical Properties |
| Boiling point | 292.8±19.0 °C(Predicted) | | density | 1.164±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | liquid | | pka | 3.11±0.40(Predicted) | | color | Brown | | Optical Rotation | [α]/D 31.0±1.5°, c = 1 in chloroform | | BRN | 5334940 | | Major Application | peptide synthesis | | InChI | 1S/C10H11NO2/c1-13-10(12)9-6-7-4-2-3-5-8(7)11-9/h2-5,9,11H,6H2,1H3/t9-/m0/s1 | | InChIKey | URORFKDEPJFPOV-VIFPVBQESA-N | | SMILES | COC(=O)[C@@H]1Cc2ccccc2N1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | 1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI) Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 1H-Indole-2-carboxylicacid,2,3-dihydro-,methylester,(2S)-(9CI) Preparation Products And Raw materials |
|