|
|
| | Cyclopentanol,2-amino-,(1S,2R)-(9CI) Basic information |
| Product Name: | Cyclopentanol,2-amino-,(1S,2R)-(9CI) | | Synonyms: | Cyclopentanol,2-amino-,(1S,2R)-(9CI);Cyclopentanol, 2-amino-, (1S,2R)-;(1S,2R)-2-Aminocyclopentanol | | CAS: | 135969-63-0 | | MF: | C5H11NO | | MW: | 101.15 | | EINECS: | | | Product Categories: | VARIOUSAMINE | | Mol File: | 135969-63-0.mol |  |
| | Cyclopentanol,2-amino-,(1S,2R)-(9CI) Chemical Properties |
| Boiling point | 179.4±33.0 °C(Predicted) | | density | 1.084±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.93±0.40(Predicted) | | InChI | InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2/t4-,5+/m1/s1 | | InChIKey | JFFOUICIRBXFRC-UHNVWZDZSA-N | | SMILES | [C@H]1(O)CCC[C@H]1N |
| | Cyclopentanol,2-amino-,(1S,2R)-(9CI) Usage And Synthesis |
| | Cyclopentanol,2-amino-,(1S,2R)-(9CI) Preparation Products And Raw materials |
|