|
|
| | 2-Methoxy-5-fluoropyridine Basic information |
| | 2-Methoxy-5-fluoropyridine Chemical Properties |
| Boiling point | 144.8±20.0 °C(Predicted) | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 0.98±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H6FNO/c1-9-6-3-2-5(7)4-8-6/h2-4H,1H3 | | InChIKey | GYGABXVZIHADCT-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=C(F)C=C1 | | CAS DataBase Reference | 51173-04-7(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | HazardClass | IRRITANT | | HazardClass | 3 | | HS Code | 2933399990 |
| | 2-Methoxy-5-fluoropyridine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Methoxy-5-fluoropyridine is an important medical intermediate and is an important fragment of a second generation TRK inhibitor LOXO-195. |
| | 2-Methoxy-5-fluoropyridine Preparation Products And Raw materials |
|