|
|
| | 5-hydroxyferulic acid Basic information |
| Product Name: | 5-hydroxyferulic acid | | Synonyms: | 5-hydroxyferulic acid;3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid;3-Methoxycaffeic acid;2-Propenoic acid, 3-(3,4-dihydroxy-5-methoxyphenyl)-;3,4-Dihydroxy-5-methoxycinnamic acid >=95.0% (HPLC) | | CAS: | 1782-55-4 | | MF: | C10H10O5 | | MW: | 210.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1782-55-4.mol |  |
| | 5-hydroxyferulic acid Chemical Properties |
| Melting point | 168-170 °C | | Boiling point | 449.1±45.0 °C(Predicted) | | density | 1.440±0.06 g/cm3(Predicted) | | pka | 4.53±0.10(Predicted) | | form | Solid | | color | Off-white to light yellow | | BRN | 2697317 | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ | | InChIKey | YFXWTVLDSKSYLW-NSCUHMNNSA-N | | SMILES | COc1cc(\C=C\C(O)=O)cc(O)c1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-hydroxyferulic acid Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: Ferulic acid in which the ring hydrogen at position 5 is substituted by hydroxy. | | Biological Activity | Secondary plant metabolite of the phenylpropanoid pathway. | | IC 50 | Human Endogenous Metabolite |
| | 5-hydroxyferulic acid Preparation Products And Raw materials |
|