| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
InvivoChem |
| Tel: |
+1-708-310-1919 +1-13798911105 |
| Email: |
sales@invivochem.cn |
|
| | 4-(3-phenanthryl)butanoic acid Basic information |
| Product Name: | 4-(3-phenanthryl)butanoic acid | | Synonyms: | 4-(3-phenanthryl)butanoic acid;HIV-1 Nef-IN-1;NSC-92828;4-(Phenanthren-3-yl)butanoic acid;3-Phenanthrenebutyric acid;antiviral,HIV 1 Nef IN 1,SH3,HIV1 NefIN1,HIV,PPI,Nef,Inhibitor,inhibit,HIV-1,Human immunodeficiency virus;HIV-1 Nef-IN-1, 10 mM in DMSO | | CAS: | 13728-56-8 | | MF: | C18H16O2 | | MW: | 264.32 | | EINECS: | | | Product Categories: | | | Mol File: | 13728-56-8.mol |  |
| | 4-(3-phenanthryl)butanoic acid Chemical Properties |
| Melting point | 138-139 °C | | Boiling point | 487.2±14.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.76±0.10(Predicted) | | color | Pale Yellow ti Light Yellow | | InChI | InChI=1S/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20) | | InChIKey | NYIVWTWKIQOBKO-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C=C2)=CC=CC=3)=CC(CCCC(O)=O)=C1 |
| | 4-(3-phenanthryl)butanoic acid Usage And Synthesis |
| Uses | 3-Phenanthrenebutanoic Acid is an intermediate in the synthesis of novel polycyclic aromatic isomers of benz[a]anthracene containing a cyclopenta-fused ring. | | IC 50 | HIV-1 Nef: 6.7 μM (Kd) |
| | 4-(3-phenanthryl)butanoic acid Preparation Products And Raw materials |
|