- SCH-37370
-
- $40.00
-
2026-05-11
- CAS:117796-52-8
- Purity: 99.92%
- Supply Ability: 10g
- Sch 37370 USP/EP/BP
-
- $1.10
-
2025-11-18
- CAS:117796-52-8
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons min
|
| | Sch 37370 Basic information |
| Product Name: | Sch 37370 | | Synonyms: | Sch 37370;1-[4-[(8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridine)-11-ylidene]piperidino]ethanone;1-Acetyl-4-[(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin)-11-ylidene]piperidine;N-Acetyldesloratadine N;1-[4-(8-chloro-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridin-11-ylidene)piperidin-1-yl]ethanone;N-acetyl base loratadine;N-AcylImpurity;Ethanone, 1-[4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinyl]- | | CAS: | 117796-52-8 | | MF: | C21H21ClN2O | | MW: | 352.86 | | EINECS: | | | Product Categories: | Aromatics, Heterocycles, Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 117796-52-8.mol |  |
| | Sch 37370 Chemical Properties |
| Melting point | 155-157 °C | | Boiling point | 546.9±50.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 4.16±0.20(Predicted) | | color | Off-White to Pale Pink | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C21H21ClN2O/c1-14(25)24-11-8-15(9-12-24)20-19-7-6-18(22)13-17(19)5-4-16-3-2-10-23-21(16)20/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3 | | InChIKey | FLTBEMVEAFMWDD-UHFFFAOYSA-N | | SMILES | C(=O)(N1CC/C(=C2\C3=NC=CC=C3CCC3=CC(Cl)=CC=C3\2)/CC1)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1 |
| | Sch 37370 Usage And Synthesis |
| Uses | N-Acetyldesloratadine is an impurity in the synthesis of Desloratadine (D290250), Nonsedating-type histamine H1-receptor antagonist. |
| | Sch 37370 Preparation Products And Raw materials |
|