|
|
| | 2-(Chloromethyl)benzonitrile Basic information |
| | 2-(Chloromethyl)benzonitrile Chemical Properties |
| Melting point | 56-61°C | | Boiling point | 252°C(lit.) | | density | 1.1976 (rough estimate) | | refractive index | 1.5437 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C8H6ClN/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5H2 | | InChIKey | ZSHNOXOGXHXLAV-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC=C1CCl | | CAS DataBase Reference | 612-13-5(CAS DataBase Reference) |
| RIDADR | UN 2923 8/6.1/PG II | | HazardClass | 8/6.1 | | PackingGroup | II | | HS Code | 2926907090 |
| | 2-(Chloromethyl)benzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | 2-(Chloromethyl)benzonitrile Preparation Products And Raw materials |
|