- FMOC-D-NLE-OH
-
- $1.00 / 1KG
-
2020-01-03
- CAS:112883-41-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | FMOC-D-NLE-OH Basic information |
| Product Name: | FMOC-D-NLE-OH | | Synonyms: | RARECHEM EM WB 0165;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-D-2-AMINOCAPROIC ACID;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-D-NORLEUCINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-D-NORLEUCINE;N-ALPHA-FMOC-D-NORLEUCINE;(R)-2-(Fmoc-amino)caproicacid);(R)-2-(Fmoc-amino)hexanoicacid;Fmoc-D-Nle-OH(Fmoc-D-norleucine | | CAS: | 112883-41-7 | | MF: | C21H23NO4 | | MW: | 353.41 | | EINECS: | | | Product Categories: | | | Mol File: | 112883-41-7.mol |  |
| | FMOC-D-NLE-OH Chemical Properties |
| Boiling point | 565.6±33.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.91±0.21(Predicted) | | form | Powder | | color | White | | Optical Rotation | Consistent with structure | | BRN | 8227505 | | Major Application | peptide synthesis | | InChI | 1S/C21H23NO4/c1-2-3-12-19(20(23)24)22-21(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,2-3,12-13H2,1H3,(H,22,25)(H,23,24)/t19-/m1/s1 | | InChIKey | VCFCFPNRQDANPN-LJQANCHMSA-N | | SMILES | N([C@H](CCCC)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 112883-41-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-NLE-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-NLE-OH Preparation Products And Raw materials |
|