|
|
| | 3-(4-METHOXYPHENOXY)BENZALDEHYDE Basic information |
| | 3-(4-METHOXYPHENOXY)BENZALDEHYDE Chemical Properties |
| Boiling point | 145 °C/0.4 mmHg (lit.) | | density | 1.089 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.596(lit.) | | Fp | >230 °F | | form | clear liquid | | color | Colorless to Yellow to Green | | Sensitive | Air Sensitive | | InChI | 1S/C14H12O3/c1-16-12-5-7-13(8-6-12)17-14-4-2-3-11(9-14)10-15/h2-10H,1H3 | | InChIKey | WLFDEVVCXPTAQA-UHFFFAOYSA-N | | SMILES | COc1ccc(Oc2cccc(C=O)c2)cc1 | | CAS DataBase Reference | 62373-80-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29124900 | | Storage Class | 10 - Combustible liquids |
| | 3-(4-METHOXYPHENOXY)BENZALDEHYDE Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID | | Uses | 3-(4-Methoxyphenoxy)benzaldehyde was used as building block in the synthesis of tetrahydroisoquinolinones. It was used as internal standard during the determination of hydrolytic activity of pyrethroids by gas chromatography-mass spectrometry. |
| | 3-(4-METHOXYPHENOXY)BENZALDEHYDE Preparation Products And Raw materials |
|