| Company Name: |
Clickchem Research LLP
|
| Tel: |
+91-8140031133 |
| Email: |
mayur@clickchemresearch.com |
| Products Intro: |
Product Name:CHLORPHENAMINE EP IMPURITY C-HCL SALT CAS:20619-12-9 Purity:90 % Above Package:25 mg, 100 mg, 250 mg, 500 mg and 1.0 gm
|
| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:Chlorphemine Impurity C CAS:20619-12-9 Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | N-desmethylchlorpheniramine Basic information |
| Product Name: | N-desmethylchlorpheniramine | | Synonyms: | N-desmethylchlorpheniramine;(3RS)-3-(4-Chlorophenyl)-N-methyl-3-(pyridin-2-yl)propan-1-amine;2-Pyridinepropanamine, γ-(4-chlorophenyl)-N-methyl-;3-(4-chlorophenyl)-N-methyl-3-pyridin-2-ylpropan-1-amine;(3RS)-3-(4-CHLOROPHENYL)-N-METHYL-3-(PYRIDIN-2-
YL)PROPAN-1-AMINE HYDROCHLORIDE;Chlorphenamine impurity C (Y0000437);Chlorphenamine EP Impurity C HCl;CHLORPHEMINE IMPURITY C | | CAS: | 20619-12-9 | | MF: | C15H17ClN2 | | MW: | 260.76 | | EINECS: | | | Product Categories: | | | Mol File: | 20619-12-9.mol |  |
| | N-desmethylchlorpheniramine Chemical Properties |
| Boiling point | 178-180 °C(Press: 2 Torr) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMF (Slightly), Methanol (Slightly) | | pka | 10.20±0.10(Predicted) | | Stability: | Air Sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H17ClN2/c1-17-11-9-14(15-4-2-3-10-18-15)12-5-7-13(16)8-6-12/h2-8,10,14,17H,9,11H2,1H3 | | InChIKey | UICFCNIVUDNZSW-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C(CCNC)c2ncccc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-desmethylchlorpheniramine Usage And Synthesis |
| Uses | Monodesmethylchlorpheniramine is an impurity of Chlorpheniramine (C424300), antihistaminic. |
| | N-desmethylchlorpheniramine Preparation Products And Raw materials |
|