|
|
| | N-isopropyltropinium Basic information |
| Product Name: | N-isopropyltropinium | | Synonyms: | N-isopropyltropinium;Ipratropium Bromide Related Compound A (10 mg) (endo-3-Hydroxy-8-isopropyl-8-methyl-8-azoniabicyclo[3.2.1]octane bromide);N-Isopropylnortropine MethobroMide (IMpurity);IpratropiuM BroMide Related CoMpound A;(8R)-3alpha-Hydroxy-8-isopropyl-1alphaH,5alphaH-tropanium bromide;N-Isopropylnortropine methobromide;(1R,3r,5S,8r)-3-Hydroxy-8-methyl-8-(1-methylethyl)-8-azoniabicyclo[3.2.1]octane bromide;N-Isopropyltropinium bromide | | CAS: | 58005-18-8 | | MF: | C11H22NO.Br | | MW: | 264.2 | | EINECS: | | | Product Categories: | | | Mol File: | 58005-18-8.mol |  |
| | N-isopropyltropinium Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1/C11H22NO.BrH/c1-8(2)12(3)9-4-5-10(12)7-11(13)6-9;/h8-11,13H,4-7H2,1-3H3;1H/q+1;/p-1/t9-,10+,11+,12; | | InChIKey | YKNOMJKDKYEKDF-RNIPKXDCNA-M | | SMILES | C([N+]1([C@H]2CC[C@@H]1C[C@H](O)C2)C)(C)C.[Br-] |&1:2,5,7,r| |
| RIDADR | UN 1544PSN2 6.1 / PGII | | WGK Germany | WGK 3 | | HS Code | 2939800000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | N-isopropyltropinium Usage And Synthesis |
| Uses | N-Isopropylnortropine Methobromide (Ipratropium EP Impurity A) is an impurity of Ipratropium (Bromide Monohydrate: I740500), an Atropine (A794625)-like bronchodilator that acts via an anticholinergic pathway, and is used to treat patients with chronic bronchitis, cardiac obstructive pulmonary disease (COPD) and asthma. |
| | N-isopropyltropinium Preparation Products And Raw materials |
|