- Gibberellin A1
-
- $88.00
-
2022-02-25
- CAS:545-97-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1 ton
- Gibberellin A1
-
- $13.65
-
2022-02-25
- CAS:545-97-1
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 3kgs
|
| | gibberellin A1 Basic information |
| Product Name: | gibberellin A1 | | Synonyms: | JLJLRLWOEMWYQK-OBDJNFEBSA-N;(1S,2S,4aR,4bR,7S,9aS,10S,10aR)-2,7-dihydroxy-1-methyl-8-methylene-13-oxododecahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid;2β,4aα,7-Trihydroxy-1β-methyl-8-methylenegibbane-1α,10β-dicarboxylic acid 1,4a-lactone;Gibberllin A1;g ibberllin g A1;Gibbane-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1α,2β,4aα,4bβ,10β)-;Gibberellin A1 100 μg/mL in Acetonitrile;GA1 | | CAS: | 545-97-1 | | MF: | C19H24O6 | | MW: | 348.39 | | EINECS: | | | Product Categories: | Agro-Products, Chiral Reagents, Heterocycles | | Mol File: | 545-97-1.mol |  |
| | gibberellin A1 Chemical Properties |
| Boiling point | 619.7±55.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | solubility | Acetone:Water (1:1): soluble; DMSO: soluble; Methanol: soluble | | form | A solid | | pka | 4.10±0.70(Predicted) | | color | White to off-white | | InChIKey | JLJLRLWOEMWYQK-XZJNCGLRNA-N | | SMILES | [C@@]123CC[C@H](O)[C@](C(=O)O1)(C)[C@@]2([H])[C@H](C(=O)O)[C@]12CC(=C)[C@](O)(CC[C@@]31[H])C2 |&1:0,3,5,10,12,16,20,24,r| |
| | gibberellin A1 Usage And Synthesis |
| Uses | Gibberellin A1 is a derivative of Gibberellic Acid (G377450), a hormone that is found in plants which promotes the growth and elongation of cells. Gibberellic acid acts as a plant growth regulator on account of its physiological and morphological effects in extremely low concentrations. | | Definition | ChEBI: A C19-gibberellin. |
| | gibberellin A1 Preparation Products And Raw materials |
| Raw materials | gibberellin A1 methyl ester-->Gibberellic acid | | Preparation Products | Gibbane-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1α,2α,4aα,4bβ,10β)--->2β,7-Dihydroxy-1β,4aα-dimethyl-8-methylenegibbane-1α,10β-dicarboxylic acid-->gibberellin A(19) |
|