- Methyl tetrahydrophthalic anhydride
-
- $6.00 / 1kg
-
2020-06-02
- CAS:19438-64-3
- Min. Order: 1kg
- Purity: High quality Professional Factory
- Supply Ability: Ms Ella chemwill_asia@126.com www.chemwill.com
|
| | Methyl tetrahydrophthalic anhydride Basic information |
| Product Name: | Methyl tetrahydrophthalic anhydride | | Synonyms: | JACS-19438-64-3;Methyltetrahydro Phthalic Anhydride (Mixture of 3- and 4- Isomers);Methyl tetrahydrophthalic anhydride;Methyl tetrahydropht;3a-Methyl-5,6-dihydro-4H-isobenzofuran-1,3-dione;5-Methyl-7,7a-dihydroisobenzofuran-1,3(3aH,6H)-dione;1,3-Isobenzofurandione, 3a,4,5,7a-tetrahydro-6-Methyl-;MTHPA,Tetrahydromethyl-1,3-isobenzofurandione | | CAS: | 19438-64-3 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 234-290-7;251-823-9 | | Product Categories: | | | Mol File: | 19438-64-3.mol |  |
| | Methyl tetrahydrophthalic anhydride Chemical Properties |
| Boiling point | 308.9±41.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H10O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h4,6-7H,2-3H2,1H3 | | InChIKey | MWSKJDNQKGCKPA-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(CCC(C)=C2)C(=O)O1 | | CAS DataBase Reference | 19438-64-3(CAS DataBase Reference) |
| | Methyl tetrahydrophthalic anhydride Usage And Synthesis |
| Chemical Properties | Methyl tetrahydrophthalic anhydride is a light yellow transparent oily liquid. It is an important intermediate in electronic information materials, medicine, pesticides, resins, and defense industries. Also It can be used in coatings, plasticizers, pesticides and other industries. | | Uses | Methyl tetrahydrophthalic anhydride can be used for unsaturated polyester resin, epoxy resin curing agent, pesticide intermediate, potting of dry-type transformer, etc. |
| | Methyl tetrahydrophthalic anhydride Preparation Products And Raw materials |
|