- Licochalcone B
-
- $48.00
-
2026-06-02
- CAS:58749-23-8
- Purity: 99.93%
- Supply Ability: 10g
- LicochalconeB
-
-
2024-04-12
- CAS:58749-23-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
- Licochalcone B
-
-
2023-02-24
- CAS:58749-23-8
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Licochalcone B Basic information |
| Product Name: | Licochalcone B | | Synonyms: | 3,4,4'-Trihydroxy-2-Methoxychalcone;(E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one;3,4,4'-Trihydroxy-2-methoxy-trans-chalcone;2-Propen-1-one,3-(3,4-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-, (2E)-;(E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one;Licoricchalcone B;Licochalcone B, 10 mM in DMSO;Licoagrochalcone B | | CAS: | 58749-23-8 | | MF: | C16H14O5 | | MW: | 286.28 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 58749-23-8.mol |  |
| | Licochalcone B Chemical Properties |
| Melting point | 196-197℃ | | Boiling point | 550.5±50.0 °C(Predicted) | | density | 1.369±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 7.80±0.15(Predicted) | | color | White | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C16H14O5/c1-21-16-11(5-9-14(19)15(16)20)4-8-13(18)10-2-6-12(17)7-3-10/h2-9,17,19-20H,1H3/b8-4+ | | InChIKey | DRDRYGIIYOPBBZ-XBXARRHUSA-N | | SMILES | C(C1=CC=C(O)C=C1)(=O)/C=C/C1=CC=C(O)C(O)=C1OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Licochalcone B Usage And Synthesis |
| Chemical Properties | Licochalcone B is a yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents,and it is derived from licorice rhizomes. | | Uses | Licochalcone B has anti-tumor, anti-inflammatory, and antioxidant effects.It can be used for content determination, identification, pharmacological experiments, etc. | | Definition | ChEBI: Licochalcone B is a member of chalcones. | | Biological Activity | Licochalcone B is extracted from Glycyrrhizainflate root. LICOCHALCONEB inhibits the self-aggregation of amyloid β (Aβ420) (IC50=2.16 μM) and disintegrates pre-formed Aβ42 fibrils, reducing metal-induced Aβ42 aggregation by chelating metal ions. | | in vivo | Licochalcone B (1-25 mg/kg, oral gavage) alleviates oxidative stress of hepatotoxicity in mice induced by CCl4[5].
| Animal Model: | Mice induced by CCl4[5] | | Dosage: | 1, 5, 25 mg/kg | | Administration: | Oral gavage. | | Result: | Elevated the levels of SOD and GSH, and reduced the GSSG levels. |
| | IC 50 | NLRP3 |
| | Licochalcone B Preparation Products And Raw materials |
|