|
|
| | Carbonic acid, methyl 2-propynyl ester Basic information |
| Product Name: | Carbonic acid, methyl 2-propynyl ester | | Synonyms: | Carbonic acid, methyl 2-propynyl ester;Carbonic acid,methyl 2-propynyl ester;Carbonic acid methylpropargyl ester;Carbonic acid O-methyl O-propargyl ester;Carbonic acid propargylmethyl ester;Methyl prop-2-ynyl carbonate;Methyl propargyl carbonate;Carbonic acid, methyl 2-propyn-1-yl ester | | CAS: | 61764-71-4 | | MF: | C5H6O3 | | MW: | 114.1 | | EINECS: | 202-075-7 | | Product Categories: | | | Mol File: | 61764-71-4.mol |  |
| | Carbonic acid, methyl 2-propynyl ester Chemical Properties |
| Boiling point | 115.5±23.0 °C(Predicted) | | density | 1.090±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C5H6O3/c1-3-4-8-5(6)7-2/h1H,4H2,2H3 | | InChIKey | AUUBCQYRIBDKHO-UHFFFAOYSA-N | | SMILES | C(OCC#C)(=O)OC |
| | Carbonic acid, methyl 2-propynyl ester Usage And Synthesis |
| | Carbonic acid, methyl 2-propynyl ester Preparation Products And Raw materials |
|