- 2-Bromoquinoxaline
-
-
2022-01-04
- CAS:36856-91-4
- Min. Order: 1g
- Purity: 98%minHPLC
- Supply Ability: 50kgs/month
- 2-Bromoquinoxaline
-
- $1.00
-
2019-07-06
- CAS:36856-91-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 200KG
|
| | 2-Bromoquinoxaline Basic information |
| | 2-Bromoquinoxaline Chemical Properties |
| Melting point | 56-60℃ | | Boiling point | 276 °C | | density | 1.656 | | Fp | 120 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | -1.32±0.30(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H5BrN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-5H | | InChIKey | XVKLMYQMVPHUPN-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)N=CC=1Br |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2-Bromoquinoxaline Usage And Synthesis |
| Chemical Properties | Light yellow solid |
| | 2-Bromoquinoxaline Preparation Products And Raw materials |
|