|
|
| | 3-Bromo-5-trifluoromethylphenol Basic information |
| Product Name: | 3-Bromo-5-trifluoromethylphenol | | Synonyms: | 3-Bromo-5-trifluoromethylphenol;3-Bromo-5-(trifluoromethyl)phenol, 5-Bromo-alpha,alpha,alpha-trifluoro-m-cresol;3-Bromo-5-hydroxybenzotrifluoride;Phenol, 3-bromo-5-(trifluoromethyl)- | | CAS: | 1025718-84-6 | | MF: | C7H4BrF3O | | MW: | 241.01 | | EINECS: | | | Product Categories: | | | Mol File: | 1025718-84-6.mol |  |
| | 3-Bromo-5-trifluoromethylphenol Chemical Properties |
| Boiling point | 224℃ | | density | 1.752 | | Fp | 89℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.00±0.10(Predicted) | | form | liquid | | color | Clear, almost colourless (hint of pink) | | InChI | InChI=1S/C7H4BrF3O/c8-5-1-4(7(9,10)11)2-6(12)3-5/h1-3,12H | | InChIKey | BWJBVICFLRSNNM-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(F)(F)F)=CC(Br)=C1 |
| HS Code | 2908990000 | | Storage Class | 11 - Combustible Solids |
| | 3-Bromo-5-trifluoromethylphenol Usage And Synthesis |
| Chemical Properties | light brown liquid |
| | 3-Bromo-5-trifluoromethylphenol Preparation Products And Raw materials |
|