|
|
| | 3-Methylbenzyl alcohol Basic information |
| | 3-Methylbenzyl alcohol Chemical Properties |
| Melting point | <-20 °C | | Boiling point | 215 °C740 mm Hg(lit.) | | density | 1.015 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.534(lit.) | | RTECS | DA4937010 | | Fp | 222 °F | | storage temp. | Store at room temperature | | pka | 14.63±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.02 | | BRN | 2324516 | | Henry's Law Constant | 2.2×101 mol/(m3Pa) at 25℃, Wang et al. (2017) | | InChI | InChI=1S/C8H10O/c1-7-3-2-4-8(5-7)6-9/h2-5,9H,6H2,1H3 | | InChIKey | JJCKHVUTVOPLBV-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=CC(C)=C1 | | LogP | 1.600 | | CAS DataBase Reference | 587-03-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methylbenzyl alcohol(587-03-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 10 - Combustible liquids |
| | 3-Methylbenzyl alcohol Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 3-Methylbenzyl Alcohol is useful for the synthesis of dialkyl aryl phosphates and dialkyl arylalkyl phosphates which possesses inhibitory activities against acetylcholinesterase (AChE) and butyrylchlorinesterase (BChE). | | Definition | ChEBI: 3-methylbenzyl alcohol is a methylbenzyl alcohol that is toluene in which one of the meta hydrogens has been replaced by a hydroxymethyl group. It is a primary alcohol and a methylbenzyl alcohol. | | General Description | 3-Methylbenzyl alcohol participates in gas phase hydrogenation of methanolic solutions of isophthaldehyde over a Ni/SiO2 catalyst. |
| | 3-Methylbenzyl alcohol Preparation Products And Raw materials |
|