|
|
| | 1-(3-Methoxyphenyl)piperazine Basic information |
| | 1-(3-Methoxyphenyl)piperazine Chemical Properties |
| Melting point | 201-204°C | | Boiling point | 150 °C/0.5 mmHg (lit.) | | density | 1.114 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5815(lit.) | | Fp | 195 °F | | solubility | DMF: 10 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml | | pka | 8.98±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Stability: | Air Sensitive | | InChI | InChI=1S/C11H16N2O/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 | | InChIKey | PZIBVWUXWNYTNL-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC(OC)=C2)CCNCC1 | | CAS DataBase Reference | 16015-71-7(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3267 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29349990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 1-(3-Methoxyphenyl)piperazine Usage And Synthesis |
| Description | 1-(3-Methoxyphenyl)piperazine (Item No. 19273) is an analytical reference standard categorized as a piperazine. This product is intended for research and forensic applications. | | Chemical Properties | white to grey or pinkish crystalline powder | | Uses | 1-(3-Methoxyphenyl)piperazine is an inhibitor of the human α1β2γ2 GABAA receptor. | | Synthesis Reference(s) | Tetrahedron Letters, 37, p. 4463, 1996 DOI: 10.1016/0040-4039(96)00877-5 | | General Description | 1-(3-Methoxyphenyl)piperazine is a piperazine derivative. | | Synthesis | The intermediate tert-butyl-4-(3-methoxyphenyl)piperazine-1-carboxylate (0.88 g, 2.88 mmol) was dissolved in 10 mL of dichloromethane, trifluoroacetic acid (0.43 mL, 5.76 mmol, 2 eq.) was added, and the reaction was carried out overnight at room temperature. Evaporated to dryness to obtain 1-(3-methoxyphenyl)piperazine. |
| | 1-(3-Methoxyphenyl)piperazine Preparation Products And Raw materials |
|