Tetramethylammonium sulfate manufacturers
|
| | Tetramethylammonium sulfate Basic information |
| | Tetramethylammonium sulfate Chemical Properties |
| Melting point | 285°C(dec.)(lit.) | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | λmax | λ: 210 nm Amax: ≤0.1
λ: 220 nm Amax: ≤0.04
λ: 230 nm Amax: ≤0.03
λ: 260 nm Amax: ≤0.02
λ: 500 nm Amax: ≤0.02 | | BRN | 3918039 | | InChI | 1S/2C4H12N.H2O4S/c3*1-5(2,3)4/h2*1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 | | InChIKey | KJFVITRRNTVAPC-UHFFFAOYSA-L | | SMILES | C[N+](C)(C)C.C[N+](C)(C)C.[O-]S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3 | | HS Code | 2923.90.0100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetramethylammonium sulfate Usage And Synthesis |
| Uses | Tetramethylammonium sulfate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | References | [1] |
| | Tetramethylammonium sulfate Preparation Products And Raw materials |
|