|
|
| | 1-Methyl-1H-pyrazole-4-boronic acid Basic information |
| | 1-Methyl-1H-pyrazole-4-boronic acid Chemical Properties |
| Boiling point | 323 ºC | | density | 1.23 | | Fp | 149 ºC | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 7.77±0.10(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C4H7BN2O2/c1-7-3-4(2-6-7)5(8)9/h2-3,8-9H,1H3 | | InChIKey | RYGOBSYXIIUFOR-UHFFFAOYSA-N | | SMILES | B(C1=CN(C)N=C1)(O)O |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 1-Methyl-1H-pyrazole-4-boronic acid Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 1-Methyl-1H-pyrazole-4-boronic acid is used in the synthesis of c-Met kinase inhibitor. | | Uses | 1-Methyl-4-pyrazoleboronic Acid is used in the synthesis of c-Met kinase inhibitor. | | Synthesis | 1-Methyl-1H-pyrazole-4-boronic acid can be prepared from 1-methyl-4-bromopyrazole by reacting with triisopropyl borate. |
| | 1-Methyl-1H-pyrazole-4-boronic acid Preparation Products And Raw materials |
|