|
|
| | 4-O-BETA-D-GULCOSYL-5-O-METHYLVISAMMINOL Basic information |
| | 4-O-BETA-D-GULCOSYL-5-O-METHYLVISAMMINOL Chemical Properties |
| Melting point | 148-150 ºC | | Boiling point | 690.4±55.0 °C(Predicted) | | density | 1.47 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 12.89±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | food and beverages | | InChIKey | QVGFPTYGKPLXPK-OOBAEQHESA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC([C@H]2Oc3c(c(c4c([o]c(c[c]4=O)C)c3)OC)C2)(C)C |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 4-O-BETA-D-GULCOSYL-5-O-METHYLVISAMMINOL Usage And Synthesis |
| Chemical Properties | White crystalline powder, easily soluble in methanol and ethanol, derived from Saposhnikovia divaricata. | | Uses | 4-O-β-D-Glucosyl-5-O-methyllvisamminol is a novel epigenetic suppressor of histone H3 phosphorylation. Potent anti-inflammatory and anti-carcinogenic agent. |
| | 4-O-BETA-D-GULCOSYL-5-O-METHYLVISAMMINOL Preparation Products And Raw materials |
|